C6H14N4O6 — CID 54515822
(2S,3R,4S,5R)-2,3,4,5-tetrahydroxyhexanedihydrazide (PubChem CID 54515822) has the molecular formula C6H14N4O6 and a molecular weight of 238.20 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2,3,4,5-tetrahydroxyhexanedihydrazide.
| Compound Name | (2S,3R,4S,5R)-2,3,4,5-tetrahydroxyhexanedihydrazide |
|---|---|
| PubChem CID | 54515822 |
| Molecular Formula | C6H14N4O6 |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | (2S,3R,4S,5R)-2,3,4,5-tetrahydroxyhexanedihydrazide |
| SMILES | NNC(=O)[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)C(=O)NN |
| InChI | InChI=1S/C6H14N4O6/c7-9-5(15)3(13)1(11)2(12)4(14)6(16)10-8/h1-4,11-14H,7-8H2,(H,9,15)(H,10,16)/t1-,2+,3+,4- |
| InChIKey | YMIIBTMEYWGWGD-DUHBMQHGSA-N |
| XLogP | -5.59 |
| TPSA | 191.16 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | -5.59 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|