C4H10N2O2 — CID 55284383
(2R)-3-amino-2-hydroxy-N-methylpropanamide (PubChem CID 55284383) has the molecular formula C4H10N2O2 and a molecular weight of 118.14 g/mol. Its IUPAC name is (2R)-3-amino-2-hydroxy-N-methylpropanamide.
| Compound Name | (2R)-3-amino-2-hydroxy-N-methylpropanamide |
|---|---|
| PubChem CID | 55284383 |
| Molecular Formula | C4H10N2O2 |
| Molecular Weight | 118.14 g/mol |
| Exact Mass | 118.07 |
| IUPAC Name | (2R)-3-amino-2-hydroxy-N-methylpropanamide |
| SMILES | CNC(=O)[C@H](O)CN |
| InChI | InChI=1S/C4H10N2O2/c1-6-4(8)3(7)2-5/h3,7H,2,5H2,1H3,(H,6,8)/t3-/m1/s1 |
| InChIKey | FGZKDJPYLCVDFZ-GSVOUGTGSA-N |
| XLogP | -1.95 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.14 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |