C5H11NO5 — CID 172822941
acetic acid;3-amino-2-hydroxypropanoic acid (PubChem CID 172822941) has the molecular formula C5H11NO5 and a molecular weight of 165.14 g/mol. Its IUPAC name is acetic acid;3-amino-2-hydroxypropanoic acid.
| Compound Name | acetic acid;3-amino-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 172822941 |
| Molecular Formula | C5H11NO5 |
| Molecular Weight | 165.14 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | acetic acid;3-amino-2-hydroxypropanoic acid |
| SMILES | CC(=O)O.NCC(O)C(=O)O |
| InChI | InChI=1S/C3H7NO3.C2H4O2/c4-1-2(5)3(6)7;1-2(3)4/h2,5H,1,4H2,(H,6,7);1H3,(H,3,4) |
| InChIKey | ULVIOUQGRHVPMN-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.14 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |