C5H9NO7 — CID 162306436
3-amino-2-hydroxypropanoic acid;oxalic acid (PubChem CID 162306436) has the molecular formula C5H9NO7 and a molecular weight of 195.13 g/mol. Its IUPAC name is 3-amino-2-hydroxypropanoic acid;oxalic acid.
| Compound Name | 3-amino-2-hydroxypropanoic acid;oxalic acid |
|---|---|
| PubChem CID | 162306436 |
| Molecular Formula | C5H9NO7 |
| Molecular Weight | 195.13 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | 3-amino-2-hydroxypropanoic acid;oxalic acid |
| SMILES | NCC(O)C(=O)O.O=C(O)C(=O)O |
| InChI | InChI=1S/C3H7NO3.C2H2O4/c4-1-2(5)3(6)7;3-1(4)2(5)6/h2,5H,1,4H2,(H,6,7);(H,3,4)(H,5,6) |
| InChIKey | XWPSVCZJPUMSMF-UHFFFAOYSA-N |
| XLogP | -2.45 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.13 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|