C5H11NO6 — CID 160945488
3-aminopropane-1,2-diol;oxalic acid (PubChem CID 160945488) has the molecular formula C5H11NO6 and a molecular weight of 181.14 g/mol. Its IUPAC name is 3-aminopropane-1,2-diol;oxalic acid.
| Compound Name | 3-aminopropane-1,2-diol;oxalic acid |
|---|---|
| PubChem CID | 160945488 |
| Molecular Formula | C5H11NO6 |
| Molecular Weight | 181.14 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | 3-aminopropane-1,2-diol;oxalic acid |
| SMILES | NCC(O)CO.O=C(O)C(=O)O |
| InChI | InChI=1S/C3H9NO2.C2H2O4/c4-1-3(6)2-5;3-1(4)2(5)6/h3,5-6H,1-2,4H2;(H,3,4)(H,5,6) |
| InChIKey | SVAYRULJDHTRGP-UHFFFAOYSA-N |
| XLogP | -2.55 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.14 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|