C7H17NO5 — CID 175213071
4-aminobutanoic acid;propane-1,2,3-triol (PubChem CID 175213071) has the molecular formula C7H17NO5 and a molecular weight of 195.21 g/mol. Its IUPAC name is 4-aminobutanoic acid;propane-1,2,3-triol.
| Compound Name | 4-aminobutanoic acid;propane-1,2,3-triol |
|---|---|
| PubChem CID | 175213071 |
| Molecular Formula | C7H17NO5 |
| Molecular Weight | 195.21 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 4-aminobutanoic acid;propane-1,2,3-triol |
| SMILES | NCCCC(=O)O.OCC(O)CO |
| InChI | InChI=1S/C4H9NO2.C3H8O3/c5-3-1-2-4(6)7;4-1-3(6)2-5/h1-3,5H2,(H,6,7);3-6H,1-2H2 |
| InChIKey | VZZVNHRSLVTHDR-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.21 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |