About 4-aminobutanoic acid;dihydrochloride
4-aminobutanoic acid;dihydrochloride (PubChem CID 87111723) has the molecular formula C4H11Cl2NO2
and a molecular weight of 176.04 g/mol. Its IUPAC name is 4-aminobutanoic acid;dihydrochloride.
Molecular Properties
| Compound Name | 4-aminobutanoic acid;dihydrochloride |
| PubChem CID | 87111723 |
| Molecular Formula | C4H11Cl2NO2 |
| Molecular Weight | 176.04 g/mol |
| Exact Mass | 175.02 |
| IUPAC Name | 4-aminobutanoic acid;dihydrochloride |
| SMILES | Cl.Cl.NCCCC(=O)O |
| InChI | InChI=1S/C4H9NO2.2ClH/c5-3-1-2-4(6)7;;/h1-3,5H2,(H,6,7);2*1H |
| InChIKey | BPRYIDIFOXDALX-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.04 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-aminobutanoic acid;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminobutanoic acid;dihydrochloride?
The IUPAC name of 4-aminobutanoic acid;dihydrochloride (CID 87111723) is 4-aminobutanoic acid;dihydrochloride.
What is the SMILES notation for 4-aminobutanoic acid;dihydrochloride?
The canonical SMILES for 4-aminobutanoic acid;dihydrochloride is Cl.Cl.NCCCC(=O)O.
What is the InChIKey of 4-aminobutanoic acid;dihydrochloride?
The InChIKey is BPRYIDIFOXDALX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO2.2ClH/c5-3-1-2-4(6)7;;/h1-3,5H2,(H,6,7);2*1H.
What are the key properties of 4-aminobutanoic acid;dihydrochloride?
4-aminobutanoic acid;dihydrochloride has a molecular weight of 176.04 g/mol, XLogP of 0.65, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobutanoic acid;dihydrochloride is sourced from PubChem (CID 87111723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).