About potassium;4-aminobutanoic acid;hydride
potassium;4-aminobutanoic acid;hydride (PubChem CID 173078667) has the molecular formula C4H10KNO2
and a molecular weight of 143.23 g/mol. Its IUPAC name is potassium;4-aminobutanoic acid;hydride.
Molecular Properties
| Compound Name | potassium;4-aminobutanoic acid;hydride |
| PubChem CID | 173078667 |
| Molecular Formula | C4H10KNO2 |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.03 |
| IUPAC Name | potassium;4-aminobutanoic acid;hydride |
| SMILES | NCCCC(=O)O.[H-].[K+] |
| InChI | InChI=1S/C4H9NO2.K.H/c5-3-1-2-4(6)7;;/h1-3,5H2,(H,6,7);;/q;+1;-1 |
| InChIKey | ZPIGMMVOBQVAJB-UHFFFAOYSA-N |
| XLogP | -3.07 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | -3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze potassium;4-aminobutanoic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;4-aminobutanoic acid;hydride?
The IUPAC name of potassium;4-aminobutanoic acid;hydride (CID 173078667) is potassium;4-aminobutanoic acid;hydride.
What is the SMILES notation for potassium;4-aminobutanoic acid;hydride?
The canonical SMILES for potassium;4-aminobutanoic acid;hydride is NCCCC(=O)O.[H-].[K+].
What is the InChIKey of potassium;4-aminobutanoic acid;hydride?
The InChIKey is ZPIGMMVOBQVAJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO2.K.H/c5-3-1-2-4(6)7;;/h1-3,5H2,(H,6,7);;/q;+1;-1.
What are the key properties of potassium;4-aminobutanoic acid;hydride?
potassium;4-aminobutanoic acid;hydride has a molecular weight of 143.23 g/mol, XLogP of -3.07, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;4-aminobutanoic acid;hydride is sourced from PubChem (CID 173078667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).