About 4-aminobutanoic acid;urea
4-aminobutanoic acid;urea (PubChem CID 87654258) has the molecular formula C5H13N3O3
and a molecular weight of 163.18 g/mol. Its IUPAC name is 4-aminobutanoic acid;urea.
Molecular Properties
| Compound Name | 4-aminobutanoic acid;urea |
| PubChem CID | 87654258 |
| Molecular Formula | C5H13N3O3 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 4-aminobutanoic acid;urea |
| SMILES | NC(N)=O.NCCCC(=O)O |
| InChI | InChI=1S/C4H9NO2.CH4N2O/c5-3-1-2-4(6)7;2-1(3)4/h1-3,5H2,(H,6,7);(H4,2,3,4) |
| InChIKey | HAOUKZAAZLHVOR-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 132.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-aminobutanoic acid;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminobutanoic acid;urea?
The IUPAC name of 4-aminobutanoic acid;urea (CID 87654258) is 4-aminobutanoic acid;urea.
What is the SMILES notation for 4-aminobutanoic acid;urea?
The canonical SMILES for 4-aminobutanoic acid;urea is NC(N)=O.NCCCC(=O)O.
What is the InChIKey of 4-aminobutanoic acid;urea?
The InChIKey is HAOUKZAAZLHVOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO2.CH4N2O/c5-3-1-2-4(6)7;2-1(3)4/h1-3,5H2,(H,6,7);(H4,2,3,4).
What are the key properties of 4-aminobutanoic acid;urea?
4-aminobutanoic acid;urea has a molecular weight of 163.18 g/mol, XLogP of -1.17, 3 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobutanoic acid;urea is sourced from PubChem (CID 87654258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).