C3H11NO3 — CID 173080490
3-aminopropane-1,2-diol;hydrate (PubChem CID 173080490) has the molecular formula C3H11NO3 and a molecular weight of 109.12 g/mol. Its IUPAC name is 3-aminopropane-1,2-diol;hydrate.
| Compound Name | 3-aminopropane-1,2-diol;hydrate |
|---|---|
| PubChem CID | 173080490 |
| Molecular Formula | C3H11NO3 |
| Molecular Weight | 109.12 g/mol |
| Exact Mass | 109.07 |
| IUPAC Name | 3-aminopropane-1,2-diol;hydrate |
| SMILES | NCC(O)CO.O |
| InChI | InChI=1S/C3H9NO2.H2O/c4-1-3(6)2-5;/h3,5-6H,1-2,4H2;1H2 |
| InChIKey | ZBQYHSDRFDWFQN-UHFFFAOYSA-N |
| XLogP | -2.53 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 109.12 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |