C10H20N2O4 — CID 129012241
methyl (2S)-2-[[(2S)-3-amino-2-hydroxypropanoyl]amino]-4-methylpentanoate (PubChem CID 129012241) has the molecular formula C10H20N2O4 and a molecular weight of 232.28 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-3-amino-2-hydroxypropanoyl]amino]-4-methylpentanoate.
| Compound Name | methyl (2S)-2-[[(2S)-3-amino-2-hydroxypropanoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 129012241 |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | methyl (2S)-2-[[(2S)-3-amino-2-hydroxypropanoyl]amino]-4-methylpentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)NC(=O)[C@@H](O)CN |
| InChI | InChI=1S/C10H20N2O4/c1-6(2)4-7(10(15)16-3)12-9(14)8(13)5-11/h6-8,13H,4-5,11H2,1-3H3,(H,12,14)/t7-,8-/m0/s1 |
| InChIKey | MWFLBYFOZYTYEE-YUMQZZPRSA-N |
| XLogP | -0.99 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |