C12H23NO4 — CID 58691175
methyl (2S)-2-[[(2S)-2-hydroxypentanoyl]amino]-4-methylpentanoate (PubChem CID 58691175) has the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-hydroxypentanoyl]amino]-4-methylpentanoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-hydroxypentanoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 58691175 |
| Molecular Formula | C12H23NO4 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-hydroxypentanoyl]amino]-4-methylpentanoate |
| SMILES | CCC[C@H](O)C(=O)N[C@@H](CC(C)C)C(=O)OC |
| InChI | InChI=1S/C12H23NO4/c1-5-6-10(14)11(15)13-9(7-8(2)3)12(16)17-4/h8-10,14H,5-7H2,1-4H3,(H,13,15)/t9-,10-/m0/s1 |
| InChIKey | NTCOGBHBNOSWCF-UWVGGRQHSA-N |
| XLogP | 0.85 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |