C8H14N2O3 — CID 174483639
acetylene;2-amino-N,3-dihydroxybutanamide (PubChem CID 174483639) has the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. Its IUPAC name is acetylene;2-amino-N,3-dihydroxybutanamide.
| Compound Name | acetylene;2-amino-N,3-dihydroxybutanamide |
|---|---|
| PubChem CID | 174483639 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | acetylene;2-amino-N,3-dihydroxybutanamide |
| SMILES | C#C.C#C.CC(O)C(N)C(=O)NO |
| InChI | InChI=1S/C4H10N2O3.2C2H2/c1-2(7)3(5)4(8)6-9;2*1-2/h2-3,7,9H,5H2,1H3,(H,6,8);2*1-2H |
| InChIKey | QZDBDUDMWZLFIK-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|