C7H15ClNO3PS — CID 15539826
methyl 2-[[chloro(propan-2-yloxy)phosphinothioyl]amino]propanoate (PubChem CID 15539826) has the molecular formula C7H15ClNO3PS and a molecular weight of 259.70 g/mol. Its IUPAC name is methyl 2-[[chloro(propan-2-yloxy)phosphinothioyl]amino]propanoate.
| Compound Name | methyl 2-[[chloro(propan-2-yloxy)phosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 15539826 |
| Molecular Formula | C7H15ClNO3PS |
| Molecular Weight | 259.70 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | methyl 2-[[chloro(propan-2-yloxy)phosphinothioyl]amino]propanoate |
| SMILES | COC(=O)C(C)NP(=S)(Cl)OC(C)C |
| InChI | InChI=1S/C7H15ClNO3PS/c1-5(2)12-13(8,14)9-6(3)7(10)11-4/h5-6H,1-4H3,(H,9,14) |
| InChIKey | KIXVVSMBZGOWFJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.70 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|