C8H18NO2PS — CID 167499810
propan-2-yl (2R)-2-(dimethylphosphinothioylamino)propanoate (PubChem CID 167499810) has the molecular formula C8H18NO2PS and a molecular weight of 223.28 g/mol. Its IUPAC name is propan-2-yl (2R)-2-(dimethylphosphinothioylamino)propanoate.
| Compound Name | propan-2-yl (2R)-2-(dimethylphosphinothioylamino)propanoate |
|---|---|
| PubChem CID | 167499810 |
| Molecular Formula | C8H18NO2PS |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | propan-2-yl (2R)-2-(dimethylphosphinothioylamino)propanoate |
| SMILES | CC(C)OC(=O)[C@@H](C)NP(C)(C)=S |
| InChI | InChI=1S/C8H18NO2PS/c1-6(2)11-8(10)7(3)9-12(4,5)13/h6-7H,1-5H3,(H,9,13)/t7-/m1/s1 |
| InChIKey | WWCYXRZCJRYONC-SSDOTTSWSA-N |
| XLogP | 1.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|