C10H23N2O5P — CID 170045491
propan-2-yl (2S)-2-[[1-aminoethoxy(methoxymethyl)phosphoryl]amino]propanoate (PubChem CID 170045491) has the molecular formula C10H23N2O5P and a molecular weight of 282.28 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[1-aminoethoxy(methoxymethyl)phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[1-aminoethoxy(methoxymethyl)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 170045491 |
| Molecular Formula | C10H23N2O5P |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | propan-2-yl (2S)-2-[[1-aminoethoxy(methoxymethyl)phosphoryl]amino]propanoate |
| SMILES | COCP(=O)(N[C@@H](C)C(=O)OC(C)C)OC(C)N |
| InChI | InChI=1S/C10H23N2O5P/c1-7(2)16-10(13)8(3)12-18(14,6-15-5)17-9(4)11/h7-9H,6,11H2,1-5H3,(H,12,14)/t8-,9?,18?/m0/s1 |
| InChIKey | KWYWMIDYBWOEMC-AMSAKSMPSA-N |
| XLogP | 1.03 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|