C13H21N2O4PS — CID 130324452
propan-2-yl (2S)-2-[[methoxymethyl(pyridin-2-ylsulfanyl)phosphoryl]amino]propanoate (PubChem CID 130324452) has the molecular formula C13H21N2O4PS and a molecular weight of 332.36 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[methoxymethyl(pyridin-2-ylsulfanyl)phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[methoxymethyl(pyridin-2-ylsulfanyl)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 130324452 |
| Molecular Formula | C13H21N2O4PS |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | propan-2-yl (2S)-2-[[methoxymethyl(pyridin-2-ylsulfanyl)phosphoryl]amino]propanoate |
| SMILES | COCP(=O)(N[C@@H](C)C(=O)OC(C)C)Sc1ccccn1 |
| InChI | InChI=1S/C13H21N2O4PS/c1-10(2)19-13(16)11(3)15-20(17,9-18-4)21-12-7-5-6-8-14-12/h5-8,10-11H,9H2,1-4H3,(H,15,17)/t11-,20?/m0/s1 |
| InChIKey | VYRGDXFFBQHPQF-ZOZMEPSFSA-N |
| XLogP | 2.90 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|