C16H26NO5P — CID 90440549
propan-2-yl 2-[[phenoxy(propan-2-yloxymethyl)phosphoryl]amino]propanoate (PubChem CID 90440549) has the molecular formula C16H26NO5P and a molecular weight of 343.36 g/mol. Its IUPAC name is propan-2-yl 2-[[phenoxy(propan-2-yloxymethyl)phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[phenoxy(propan-2-yloxymethyl)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 90440549 |
| Molecular Formula | C16H26NO5P |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | propan-2-yl 2-[[phenoxy(propan-2-yloxymethyl)phosphoryl]amino]propanoate |
| SMILES | CC(C)OCP(=O)(NC(C)C(=O)OC(C)C)Oc1ccccc1 |
| InChI | InChI=1S/C16H26NO5P/c1-12(2)20-11-23(19,22-15-9-7-6-8-10-15)17-14(5)16(18)21-13(3)4/h6-10,12-14H,11H2,1-5H3,(H,17,19) |
| InChIKey | ACZFUZGWELBXQM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|