C18H30NO5P — CID 118967597
propan-2-yl 2-[[3-methylbutan-2-yloxymethyl(phenoxy)phosphoryl]amino]propanoate (PubChem CID 118967597) has the molecular formula C18H30NO5P and a molecular weight of 371.41 g/mol. Its IUPAC name is propan-2-yl 2-[[3-methylbutan-2-yloxymethyl(phenoxy)phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[3-methylbutan-2-yloxymethyl(phenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 118967597 |
| Molecular Formula | C18H30NO5P |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | propan-2-yl 2-[[3-methylbutan-2-yloxymethyl(phenoxy)phosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)C(C)NP(=O)(COC(C)C(C)C)Oc1ccccc1 |
| InChI | InChI=1S/C18H30NO5P/c1-13(2)16(6)22-12-25(21,24-17-10-8-7-9-11-17)19-15(5)18(20)23-14(3)4/h7-11,13-16H,12H2,1-6H3,(H,19,21) |
| InChIKey | KEOIVOYHAOGPIQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|