C13H25N2O5P — CID 130324120
propan-2-yl (2S)-2-[[methoxymethyl-(2-oxopiperidin-1-yl)phosphoryl]amino]propanoate (PubChem CID 130324120) has the molecular formula C13H25N2O5P and a molecular weight of 320.33 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[methoxymethyl-(2-oxopiperidin-1-yl)phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[methoxymethyl-(2-oxopiperidin-1-yl)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 130324120 |
| Molecular Formula | C13H25N2O5P |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | propan-2-yl (2S)-2-[[methoxymethyl-(2-oxopiperidin-1-yl)phosphoryl]amino]propanoate |
| SMILES | COCP(=O)(N[C@@H](C)C(=O)OC(C)C)N1CCCCC1=O |
| InChI | InChI=1S/C13H25N2O5P/c1-10(2)20-13(17)11(3)14-21(18,9-19-4)15-8-6-5-7-12(15)16/h10-11H,5-9H2,1-4H3,(H,14,18)/t11-,21?/m0/s1 |
| InChIKey | ABRWPTVNGOYSMK-QHIQZGGMSA-N |
| XLogP | 1.73 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|