C27H35ClN3O4P — CID 130324008
propan-2-yl (2S)-2-[[[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-(methoxymethyl)phosphoryl]amino]propanoate (PubChem CID 130324008) has the molecular formula C27H35ClN3O4P and a molecular weight of 532.02 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-(methoxymethyl)phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-(methoxymethyl)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 130324008 |
| Molecular Formula | C27H35ClN3O4P |
| Molecular Weight | 532.02 g/mol |
| Exact Mass | 531.21 |
| IUPAC Name | propan-2-yl (2S)-2-[[[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-(methoxymethyl)phosphoryl]amino]propanoate |
| SMILES | COCP(=O)(N[C@@H](C)C(=O)OC(C)C)N1CCC(=C2c3ccc(Cl)cc3CCc3cccnc32)CC1 |
| InChI | InChI=1S/C27H35ClN3O4P/c1-18(2)35-27(32)19(3)30-36(33,17-34-4)31-14-11-20(12-15-31)25-24-10-9-23(28)16-22(24)8-7-21-6-5-13-29-26(21)25/h5-6,9-10,13,16,18-19H,7-8,11-12,14-15,17H2,1-4H3,(H,30,33)/t19-,36?/m0/s1 |
| InChIKey | MUPVQCGTBUILKH-VPTCXKPOSA-N |
| XLogP | 5.46 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.02 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|