C25H28ClN3O2 — CID 170271657
pyrrolidin-1-ylmethyl 4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate (PubChem CID 170271657) has the molecular formula C25H28ClN3O2 and a molecular weight of 437.97 g/mol. Its IUPAC name is pyrrolidin-1-ylmethyl 4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate.
| Compound Name | pyrrolidin-1-ylmethyl 4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 170271657 |
| Molecular Formula | C25H28ClN3O2 |
| Molecular Weight | 437.97 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | pyrrolidin-1-ylmethyl 4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate |
| SMILES | O=C(OCN1CCCC1)N1CCC(=C2c3ccc(Cl)cc3CCc3cccnc32)CC1 |
| InChI | InChI=1S/C25H28ClN3O2/c26-21-7-8-22-20(16-21)6-5-19-4-3-11-27-24(19)23(22)18-9-14-29(15-10-18)25(30)31-17-28-12-1-2-13-28/h3-4,7-8,11,16H,1-2,5-6,9-10,12-15,17H2 |
| InChIKey | GQTXOVLPJLNPHN-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.97 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |