C22H23ClN2O2Se — CID 89157201
CID 89157201 (PubChem CID 89157201) has the molecular formula C22H23ClN2O2Se and a molecular weight of 461.85 g/mol.
| Compound Name | CID 89157201 |
|---|---|
| PubChem CID | 89157201 |
| Molecular Formula | C22H23ClN2O2Se |
| Molecular Weight | 461.85 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | — |
| SMILES | CCOC(=O)N1CCC(=C2c3ccc(Cl)cc3CCc3cccnc32)CC1.[Se] |
| InChI | InChI=1S/C22H23ClN2O2.Se/c1-2-27-22(26)25-12-9-15(10-13-25)20-19-8-7-18(23)14-17(19)6-5-16-4-3-11-24-21(16)20;/h3-4,7-8,11,14H,2,5-6,9-10,12-13H2,1H3; |
| InChIKey | WEPOZSOVXKMILH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.85 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|