About CID 89157201
CID 89157201 (PubChem CID 89157201) has the molecular formula C22H23ClN2O2Se
and a molecular weight of 461.85 g/mol.
Molecular Properties
| Compound Name | CID 89157201 |
| PubChem CID | 89157201 |
| Molecular Formula | C22H23ClN2O2Se |
| Molecular Weight | 461.85 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | — |
| SMILES | CCOC(=O)N1CCC(=C2c3ccc(Cl)cc3CCc3cccnc32)CC1.[Se] |
| InChI | InChI=1S/C22H23ClN2O2.Se/c1-2-27-22(26)25-12-9-15(10-13-25)20-19-8-7-18(23)14-17(19)6-5-16-4-3-11-24-21(16)20;/h3-4,7-8,11,14H,2,5-6,9-10,12-13H2,1H3; |
| InChIKey | WEPOZSOVXKMILH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 461.85 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 89157201 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89157201?
The IUPAC name of CID 89157201 (CID 89157201) is not available.
What is the SMILES notation for CID 89157201?
The canonical SMILES for CID 89157201 is CCOC(=O)N1CCC(=C2c3ccc(Cl)cc3CCc3cccnc32)CC1.[Se].
What is the InChIKey of CID 89157201?
The InChIKey is WEPOZSOVXKMILH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23ClN2O2.Se/c1-2-27-22(26)25-12-9-15(10-13-25)20-19-8-7-18(23)14-17(19)6-5-16-4-3-11-24-21(16)20;/h3-4,7-8,11,14H,2,5-6,9-10,12-13H2,1H3;.
What are the key properties of CID 89157201?
CID 89157201 has a molecular weight of 461.85 g/mol, XLogP of 4.51, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89157201 is sourced from PubChem (CID 89157201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).