C25H29ClN2O4 — CID 174750636
ethyl 4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate;ethyl formate (PubChem CID 174750636) has the molecular formula C25H29ClN2O4 and a molecular weight of 456.97 g/mol. Its IUPAC name is ethyl 4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate;ethyl formate.
| Compound Name | ethyl 4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate;ethyl formate |
|---|---|
| PubChem CID | 174750636 |
| Molecular Formula | C25H29ClN2O4 |
| Molecular Weight | 456.97 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | ethyl 4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate;ethyl formate |
| SMILES | CCOC(=O)N1CCC(=C2c3ccc(Cl)cc3CCc3cccnc32)CC1.CCOC=O |
| InChI | InChI=1S/C22H23ClN2O2.C3H6O2/c1-2-27-22(26)25-12-9-15(10-13-25)20-19-8-7-18(23)14-17(19)6-5-16-4-3-11-24-21(16)20;1-2-5-3-4/h3-4,7-8,11,14H,2,5-6,9-10,12-13H2,1H3;3H,2H2,1H3 |
| InChIKey | MCJMWPVEDVCASM-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.97 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|