C7H15ClNO4P — CID 130324026
ethyl (2S)-2-[[chloro(methoxymethyl)phosphoryl]amino]propanoate (PubChem CID 130324026) has the molecular formula C7H15ClNO4P and a molecular weight of 243.63 g/mol. Its IUPAC name is ethyl (2S)-2-[[chloro(methoxymethyl)phosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[chloro(methoxymethyl)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 130324026 |
| Molecular Formula | C7H15ClNO4P |
| Molecular Weight | 243.63 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | ethyl (2S)-2-[[chloro(methoxymethyl)phosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(Cl)COC |
| InChI | InChI=1S/C7H15ClNO4P/c1-4-13-7(10)6(2)9-14(8,11)5-12-3/h6H,4-5H2,1-3H3,(H,9,11)/t6-,14?/m0/s1 |
| InChIKey | GVJUOLLUBALRPQ-TZKMECQKSA-N |
| XLogP | 1.56 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.63 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|