About ethyl 2-[[dimethyl(methylimino)-λ5-phosphanyl]amino]propanoate;methane
ethyl 2-[[dimethyl(methylimino)-λ5-phosphanyl]amino]propanoate;methane (PubChem CID 161235723) has the molecular formula C10H27N2O2P
and a molecular weight of 238.31 g/mol. Its IUPAC name is ethyl 2-[[dimethyl(methylimino)-λ5-phosphanyl]amino]propanoate;methane.
Molecular Properties
| Compound Name | ethyl 2-[[dimethyl(methylimino)-λ5-phosphanyl]amino]propanoate;methane |
| PubChem CID | 161235723 |
| Molecular Formula | C10H27N2O2P |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | ethyl 2-[[dimethyl(methylimino)-λ5-phosphanyl]amino]propanoate;methane |
| SMILES | C.C.CCOC(=O)C(C)NP(C)(C)=NC |
| InChI | InChI=1S/C8H19N2O2P.2CH4/c1-6-12-8(11)7(2)10-13(4,5)9-3;;/h7,10H,6H2,1-5H3;2*1H4 |
| InChIKey | UZINPRCEVAFKNO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[[dimethyl(methylimino)-λ5-phosphanyl]amino]propanoate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[[dimethyl(methylimino)-λ5-phosphanyl]amino]propanoate;methane?
The IUPAC name of ethyl 2-[[dimethyl(methylimino)-λ5-phosphanyl]amino]propanoate;methane (CID 161235723) is ethyl 2-[[dimethyl(methylimino)-λ5-phosphanyl]amino]propanoate;methane.
What is the SMILES notation for ethyl 2-[[dimethyl(methylimino)-λ5-phosphanyl]amino]propanoate;methane?
The canonical SMILES for ethyl 2-[[dimethyl(methylimino)-λ5-phosphanyl]amino]propanoate;methane is C.C.CCOC(=O)C(C)NP(C)(C)=NC.
What is the InChIKey of ethyl 2-[[dimethyl(methylimino)-λ5-phosphanyl]amino]propanoate;methane?
The InChIKey is UZINPRCEVAFKNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N2O2P.2CH4/c1-6-12-8(11)7(2)10-13(4,5)9-3;;/h7,10H,6H2,1-5H3;2*1H4.
What are the key properties of ethyl 2-[[dimethyl(methylimino)-λ5-phosphanyl]amino]propanoate;methane?
ethyl 2-[[dimethyl(methylimino)-λ5-phosphanyl]amino]propanoate;methane has a molecular weight of 238.31 g/mol, XLogP of 2.81, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[[dimethyl(methylimino)-λ5-phosphanyl]amino]propanoate;methane is sourced from PubChem (CID 161235723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).