C17H23N2O6P — CID 134594535
propan-2-yl (2S)-2-[[(2-methylidene-5-oxopyrrolidin-1-yl)oxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 134594535) has the molecular formula C17H23N2O6P and a molecular weight of 382.35 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[(2-methylidene-5-oxopyrrolidin-1-yl)oxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[(2-methylidene-5-oxopyrrolidin-1-yl)oxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 134594535 |
| Molecular Formula | C17H23N2O6P |
| Molecular Weight | 382.35 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | propan-2-yl (2S)-2-[[(2-methylidene-5-oxopyrrolidin-1-yl)oxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C=C1CCC(=O)N1OP(=O)(N[C@@H](C)C(=O)OC(C)C)Oc1ccccc1 |
| InChI | InChI=1S/C17H23N2O6P/c1-12(2)23-17(21)14(4)18-26(22,24-15-8-6-5-7-9-15)25-19-13(3)10-11-16(19)20/h5-9,12,14H,3,10-11H2,1-2,4H3,(H,18,22)/t14-,26?/m0/s1 |
| InChIKey | SSXXBRULRVWSCT-BAHZEXJQSA-N |
| XLogP | 3.17 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|