C18H23N4O8P — CID 126608616
propan-2-yl (2S)-2-[[[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)amino]oxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 126608616) has the molecular formula C18H23N4O8P and a molecular weight of 454.38 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)amino]oxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)amino]oxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 126608616 |
| Molecular Formula | C18H23N4O8P |
| Molecular Weight | 454.38 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)amino]oxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)N[P@](=O)(ON=C1C(=O)N(C)C(=O)N(C)C1=O)Oc1ccccc1 |
| InChI | InChI=1S/C18H23N4O8P/c1-11(2)28-17(25)12(3)20-31(27,29-13-9-7-6-8-10-13)30-19-14-15(23)21(4)18(26)22(5)16(14)24/h6-12H,1-5H3,(H,20,27)/t12-,31+/m0/s1 |
| InChIKey | XHWXSEDJLCHQHQ-ZDUYTPDQSA-N |
| XLogP | 1.53 |
| TPSA | 143.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.38 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_sixes(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|