C19H20F4NO5P — CID 130377334
propan-2-yl (2R)-2-[[phenoxy-(2,3,4,6-tetrafluoro-5-methylphenoxy)phosphoryl]amino]propanoate (PubChem CID 130377334) has the molecular formula C19H20F4NO5P and a molecular weight of 449.34 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[phenoxy-(2,3,4,6-tetrafluoro-5-methylphenoxy)phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2R)-2-[[phenoxy-(2,3,4,6-tetrafluoro-5-methylphenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 130377334 |
| Molecular Formula | C19H20F4NO5P |
| Molecular Weight | 449.34 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | propan-2-yl (2R)-2-[[phenoxy-(2,3,4,6-tetrafluoro-5-methylphenoxy)phosphoryl]amino]propanoate |
| SMILES | Cc1c(F)c(F)c(F)c(O[P@](=O)(N[C@H](C)C(=O)OC(C)C)Oc2ccccc2)c1F |
| InChI | InChI=1S/C19H20F4NO5P/c1-10(2)27-19(25)12(4)24-30(26,28-13-8-6-5-7-9-13)29-18-15(21)11(3)14(20)16(22)17(18)23/h5-10,12H,1-4H3,(H,24,26)/t12-,30+/m1/s1 |
| InChIKey | YNBRHUXMGILKAS-SSUCQYSQSA-N |
| XLogP | 5.05 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.34 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|