C17H26NO3P — CID 142963706
propan-2-yl 2-[(cyclopropylidene-ethyl-phenoxy-λ5-phosphanyl)amino]propanoate (PubChem CID 142963706) has the molecular formula C17H26NO3P and a molecular weight of 323.37 g/mol. Its IUPAC name is propan-2-yl 2-[(cyclopropylidene-ethyl-phenoxy-λ5-phosphanyl)amino]propanoate.
| Compound Name | propan-2-yl 2-[(cyclopropylidene-ethyl-phenoxy-λ5-phosphanyl)amino]propanoate |
|---|---|
| PubChem CID | 142963706 |
| Molecular Formula | C17H26NO3P |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | propan-2-yl 2-[(cyclopropylidene-ethyl-phenoxy-λ5-phosphanyl)amino]propanoate |
| SMILES | CCP(NC(C)C(=O)OC(C)C)(Oc1ccccc1)=C1CC1 |
| InChI | InChI=1S/C17H26NO3P/c1-5-22(16-11-12-16,21-15-9-7-6-8-10-15)18-14(4)17(19)20-13(2)3/h6-10,13-14,18H,5,11-12H2,1-4H3 |
| InChIKey | AGXHJEUJVWEWRD-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|