C15H24NO3PS2 — CID 126586789
propan-2-yl (2R)-2-[[phenoxy(1-sulfanylpropan-2-yl)phosphinothioyl]amino]propanoate (PubChem CID 126586789) has the molecular formula C15H24NO3PS2 and a molecular weight of 361.47 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[phenoxy(1-sulfanylpropan-2-yl)phosphinothioyl]amino]propanoate.
| Compound Name | propan-2-yl (2R)-2-[[phenoxy(1-sulfanylpropan-2-yl)phosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 126586789 |
| Molecular Formula | C15H24NO3PS2 |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | propan-2-yl (2R)-2-[[phenoxy(1-sulfanylpropan-2-yl)phosphinothioyl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@@H](C)NP(=S)(Oc1ccccc1)C(C)CS |
| InChI | InChI=1S/C15H24NO3PS2/c1-11(2)18-15(17)13(4)16-20(22,12(3)10-21)19-14-8-6-5-7-9-14/h5-9,11-13,21H,10H2,1-4H3,(H,16,22)/t12?,13-,20?/m1/s1 |
| InChIKey | ISVHSEURVXTGRC-DAIAYTDJSA-N |
| XLogP | 3.62 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|