C19H24NO4PS — CID 130465437
propan-2-yl (2S)-2-[[(4-methylphenyl)sulfanyl-phenoxyphosphoryl]amino]propanoate (PubChem CID 130465437) has the molecular formula C19H24NO4PS and a molecular weight of 393.45 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[(4-methylphenyl)sulfanyl-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[(4-methylphenyl)sulfanyl-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 130465437 |
| Molecular Formula | C19H24NO4PS |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | propan-2-yl (2S)-2-[[(4-methylphenyl)sulfanyl-phenoxyphosphoryl]amino]propanoate |
| SMILES | Cc1ccc(S[P@](=O)(N[C@@H](C)C(=O)OC(C)C)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C19H24NO4PS/c1-14(2)23-19(21)16(4)20-25(22,24-17-8-6-5-7-9-17)26-18-12-10-15(3)11-13-18/h5-14,16H,1-4H3,(H,20,22)/t16-,25-/m0/s1 |
| InChIKey | OXPWXWNEZRORRB-LMKMVOKYSA-N |
| XLogP | 5.20 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|