C13H26NO6P — CID 145072882
[methyl-[[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphoryl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 145072882) has the molecular formula C13H26NO6P and a molecular weight of 323.33 g/mol. Its IUPAC name is [methyl-[[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphoryl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [methyl-[[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphoryl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 145072882 |
| Molecular Formula | C13H26NO6P |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | [methyl-[[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphoryl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(C)(=O)OCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C13H26NO6P/c1-9(2)20-11(15)10(3)14-21(7,17)19-8-18-12(16)13(4,5)6/h9-10H,8H2,1-7H3,(H,14,17)/t10-,21?/m0/s1 |
| InChIKey | QXJKSKBSMKVPLS-LPOBJOOYSA-N |
| XLogP | 2.30 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|