About [3,3-dimethylbutan-2-yloxymethoxy(propan-2-yl)phosphoryl]oxymethyl 2,2-dimethylpropanoate
[3,3-dimethylbutan-2-yloxymethoxy(propan-2-yl)phosphoryl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 130417351) has the molecular formula C16H33O6P
and a molecular weight of 352.41 g/mol. Its IUPAC name is [3,3-dimethylbutan-2-yloxymethoxy(propan-2-yl)phosphoryl]oxymethyl 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [3,3-dimethylbutan-2-yloxymethoxy(propan-2-yl)phosphoryl]oxymethyl 2,2-dimethylpropanoate |
| PubChem CID | 130417351 |
| Molecular Formula | C16H33O6P |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | [3,3-dimethylbutan-2-yloxymethoxy(propan-2-yl)phosphoryl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(OCOP(=O)(OCOC(=O)C(C)(C)C)C(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H33O6P/c1-12(2)23(18,21-10-19-13(3)15(4,5)6)22-11-20-14(17)16(7,8)9/h12-13H,10-11H2,1-9H3 |
| InChIKey | IPRVKDMBMJRSHV-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [3,3-dimethylbutan-2-yloxymethoxy(propan-2-yl)phosphoryl]oxymethyl 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,3-dimethylbutan-2-yloxymethoxy(propan-2-yl)phosphoryl]oxymethyl 2,2-dimethylpropanoate?
The IUPAC name of [3,3-dimethylbutan-2-yloxymethoxy(propan-2-yl)phosphoryl]oxymethyl 2,2-dimethylpropanoate (CID 130417351) is [3,3-dimethylbutan-2-yloxymethoxy(propan-2-yl)phosphoryl]oxymethyl 2,2-dimethylpropanoate.
What is the SMILES notation for [3,3-dimethylbutan-2-yloxymethoxy(propan-2-yl)phosphoryl]oxymethyl 2,2-dimethylpropanoate?
The canonical SMILES for [3,3-dimethylbutan-2-yloxymethoxy(propan-2-yl)phosphoryl]oxymethyl 2,2-dimethylpropanoate is CC(OCOP(=O)(OCOC(=O)C(C)(C)C)C(C)C)C(C)(C)C.
What is the InChIKey of [3,3-dimethylbutan-2-yloxymethoxy(propan-2-yl)phosphoryl]oxymethyl 2,2-dimethylpropanoate?
The InChIKey is IPRVKDMBMJRSHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33O6P/c1-12(2)23(18,21-10-19-13(3)15(4,5)6)22-11-20-14(17)16(7,8)9/h12-13H,10-11H2,1-9H3.
What are the key properties of [3,3-dimethylbutan-2-yloxymethoxy(propan-2-yl)phosphoryl]oxymethyl 2,2-dimethylpropanoate?
[3,3-dimethylbutan-2-yloxymethoxy(propan-2-yl)phosphoryl]oxymethyl 2,2-dimethylpropanoate has a molecular weight of 352.41 g/mol, XLogP of 4.58, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3,3-dimethylbutan-2-yloxymethoxy(propan-2-yl)phosphoryl]oxymethyl 2,2-dimethylpropanoate is sourced from PubChem (CID 130417351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).