C16H33O6P — CID 130417351
[3,3-dimethylbutan-2-yloxymethoxy(propan-2-yl)phosphoryl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 130417351) has the molecular formula C16H33O6P and a molecular weight of 352.41 g/mol. Its IUPAC name is [3,3-dimethylbutan-2-yloxymethoxy(propan-2-yl)phosphoryl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [3,3-dimethylbutan-2-yloxymethoxy(propan-2-yl)phosphoryl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 130417351 |
| Molecular Formula | C16H33O6P |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | [3,3-dimethylbutan-2-yloxymethoxy(propan-2-yl)phosphoryl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(OCOP(=O)(OCOC(=O)C(C)(C)C)C(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H33O6P/c1-12(2)23(18,21-10-19-13(3)15(4,5)6)22-11-20-14(17)16(7,8)9/h12-13H,10-11H2,1-9H3 |
| InChIKey | IPRVKDMBMJRSHV-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|