C10H21Cl2N2O4P — CID 72551281
bis(2-chloroethylamino)phosphoryloxymethyl 2,2-dimethylpropanoate (PubChem CID 72551281) has the molecular formula C10H21Cl2N2O4P and a molecular weight of 335.17 g/mol. Its IUPAC name is bis(2-chloroethylamino)phosphoryloxymethyl 2,2-dimethylpropanoate.
| Compound Name | bis(2-chloroethylamino)phosphoryloxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 72551281 |
| Molecular Formula | C10H21Cl2N2O4P |
| Molecular Weight | 335.17 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | bis(2-chloroethylamino)phosphoryloxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCOP(=O)(NCCCl)NCCCl |
| InChI | InChI=1S/C10H21Cl2N2O4P/c1-10(2,3)9(15)17-8-18-19(16,13-6-4-11)14-7-5-12/h4-8H2,1-3H3,(H2,13,14,16) |
| InChIKey | WKJFTHHSWBLOMC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.17 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|