C10H21NO2 — CID 89201508
[(2S)-2-amino-3-methylbutyl] 2,2-dimethylpropanoate (PubChem CID 89201508) has the molecular formula C10H21NO2 and a molecular weight of 187.28 g/mol. Its IUPAC name is [(2S)-2-amino-3-methylbutyl] 2,2-dimethylpropanoate.
| Compound Name | [(2S)-2-amino-3-methylbutyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 89201508 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | [(2S)-2-amino-3-methylbutyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)[C@H](N)COC(=O)C(C)(C)C |
| InChI | InChI=1S/C10H21NO2/c1-7(2)8(11)6-13-9(12)10(3,4)5/h7-8H,6,11H2,1-5H3/t8-/m1/s1 |
| InChIKey | DXDRZTAEZXFEIB-MRVPVSSYSA-N |
| XLogP | 1.56 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |