About [2-methyl-1-(2-methylpropoxy)-1-oxopropan-2-yl] 2,2-dimethylpropanoate
[2-methyl-1-(2-methylpropoxy)-1-oxopropan-2-yl] 2,2-dimethylpropanoate (PubChem CID 153381894) has the molecular formula C13H24O4
and a molecular weight of 244.33 g/mol. Its IUPAC name is [2-methyl-1-(2-methylpropoxy)-1-oxopropan-2-yl] 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [2-methyl-1-(2-methylpropoxy)-1-oxopropan-2-yl] 2,2-dimethylpropanoate |
| PubChem CID | 153381894 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | [2-methyl-1-(2-methylpropoxy)-1-oxopropan-2-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)COC(=O)C(C)(C)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C13H24O4/c1-9(2)8-16-11(15)13(6,7)17-10(14)12(3,4)5/h9H,8H2,1-7H3 |
| InChIKey | ARFUUVWQJAWLJK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-methyl-1-(2-methylpropoxy)-1-oxopropan-2-yl] 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-methyl-1-(2-methylpropoxy)-1-oxopropan-2-yl] 2,2-dimethylpropanoate?
The IUPAC name of [2-methyl-1-(2-methylpropoxy)-1-oxopropan-2-yl] 2,2-dimethylpropanoate (CID 153381894) is [2-methyl-1-(2-methylpropoxy)-1-oxopropan-2-yl] 2,2-dimethylpropanoate.
What is the SMILES notation for [2-methyl-1-(2-methylpropoxy)-1-oxopropan-2-yl] 2,2-dimethylpropanoate?
The canonical SMILES for [2-methyl-1-(2-methylpropoxy)-1-oxopropan-2-yl] 2,2-dimethylpropanoate is CC(C)COC(=O)C(C)(C)OC(=O)C(C)(C)C.
What is the InChIKey of [2-methyl-1-(2-methylpropoxy)-1-oxopropan-2-yl] 2,2-dimethylpropanoate?
The InChIKey is ARFUUVWQJAWLJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O4/c1-9(2)8-16-11(15)13(6,7)17-10(14)12(3,4)5/h9H,8H2,1-7H3.
What are the key properties of [2-methyl-1-(2-methylpropoxy)-1-oxopropan-2-yl] 2,2-dimethylpropanoate?
[2-methyl-1-(2-methylpropoxy)-1-oxopropan-2-yl] 2,2-dimethylpropanoate has a molecular weight of 244.33 g/mol, XLogP of 2.55, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-methyl-1-(2-methylpropoxy)-1-oxopropan-2-yl] 2,2-dimethylpropanoate is sourced from PubChem (CID 153381894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).