C18H34O6 — CID 139989397
bis(2-methylpropyl) 2,3-diethoxy-2,3-dimethylbutanedioate (PubChem CID 139989397) has the molecular formula C18H34O6 and a molecular weight of 346.46 g/mol. Its IUPAC name is bis(2-methylpropyl) 2,3-diethoxy-2,3-dimethylbutanedioate.
| Compound Name | bis(2-methylpropyl) 2,3-diethoxy-2,3-dimethylbutanedioate |
|---|---|
| PubChem CID | 139989397 |
| Molecular Formula | C18H34O6 |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | bis(2-methylpropyl) 2,3-diethoxy-2,3-dimethylbutanedioate |
| SMILES | CCOC(C)(C(=O)OCC(C)C)C(C)(OCC)C(=O)OCC(C)C |
| InChI | InChI=1S/C18H34O6/c1-9-23-17(7,15(19)21-11-13(3)4)18(8,24-10-2)16(20)22-12-14(5)6/h13-14H,9-12H2,1-8H3 |
| InChIKey | BAAWBXAKTSLZOM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |