C17H32O4 — CID 126725784
1-O-butyl 5-O-(2-methylpropyl) 2,2,4,4-tetramethylpentanedioate (PubChem CID 126725784) has the molecular formula C17H32O4 and a molecular weight of 300.44 g/mol. Its IUPAC name is 1-O-butyl 5-O-(2-methylpropyl) 2,2,4,4-tetramethylpentanedioate.
| Compound Name | 1-O-butyl 5-O-(2-methylpropyl) 2,2,4,4-tetramethylpentanedioate |
|---|---|
| PubChem CID | 126725784 |
| Molecular Formula | C17H32O4 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | 1-O-butyl 5-O-(2-methylpropyl) 2,2,4,4-tetramethylpentanedioate |
| SMILES | CCCCOC(=O)C(C)(C)CC(C)(C)C(=O)OCC(C)C |
| InChI | InChI=1S/C17H32O4/c1-8-9-10-20-14(18)16(4,5)12-17(6,7)15(19)21-11-13(2)3/h13H,8-12H2,1-7H3 |
| InChIKey | GHKLXTOKRAXYFH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|