About bis(2-methylpropyl) 2,2,3-trimethylbutanedioate
bis(2-methylpropyl) 2,2,3-trimethylbutanedioate (PubChem CID 22639843) has the molecular formula C15H28O4
and a molecular weight of 272.38 g/mol. Its IUPAC name is bis(2-methylpropyl) 2,2,3-trimethylbutanedioate.
Molecular Properties
| Compound Name | bis(2-methylpropyl) 2,2,3-trimethylbutanedioate |
| PubChem CID | 22639843 |
| Molecular Formula | C15H28O4 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | bis(2-methylpropyl) 2,2,3-trimethylbutanedioate |
| SMILES | CC(C)COC(=O)C(C)C(C)(C)C(=O)OCC(C)C |
| InChI | InChI=1S/C15H28O4/c1-10(2)8-18-13(16)12(5)15(6,7)14(17)19-9-11(3)4/h10-12H,8-9H2,1-7H3 |
| InChIKey | RREHKLQGUDYKJV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(2-methylpropyl) 2,2,3-trimethylbutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methylpropyl) 2,2,3-trimethylbutanedioate?
The IUPAC name of bis(2-methylpropyl) 2,2,3-trimethylbutanedioate (CID 22639843) is bis(2-methylpropyl) 2,2,3-trimethylbutanedioate.
What is the SMILES notation for bis(2-methylpropyl) 2,2,3-trimethylbutanedioate?
The canonical SMILES for bis(2-methylpropyl) 2,2,3-trimethylbutanedioate is CC(C)COC(=O)C(C)C(C)(C)C(=O)OCC(C)C.
What is the InChIKey of bis(2-methylpropyl) 2,2,3-trimethylbutanedioate?
The InChIKey is RREHKLQGUDYKJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O4/c1-10(2)8-18-13(16)12(5)15(6,7)14(17)19-9-11(3)4/h10-12H,8-9H2,1-7H3.
What are the key properties of bis(2-methylpropyl) 2,2,3-trimethylbutanedioate?
bis(2-methylpropyl) 2,2,3-trimethylbutanedioate has a molecular weight of 272.38 g/mol, XLogP of 3.05, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylpropyl) 2,2,3-trimethylbutanedioate is sourced from PubChem (CID 22639843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).