C25H44O4 — CID 141091368
bis(2-methylpropyl) 2,2-dicyclohexyl-3-methylbutanedioate (PubChem CID 141091368) has the molecular formula C25H44O4 and a molecular weight of 408.62 g/mol. Its IUPAC name is bis(2-methylpropyl) 2,2-dicyclohexyl-3-methylbutanedioate.
| Compound Name | bis(2-methylpropyl) 2,2-dicyclohexyl-3-methylbutanedioate |
|---|---|
| PubChem CID | 141091368 |
| Molecular Formula | C25H44O4 |
| Molecular Weight | 408.62 g/mol |
| Exact Mass | 408.32 |
| IUPAC Name | bis(2-methylpropyl) 2,2-dicyclohexyl-3-methylbutanedioate |
| SMILES | CC(C)COC(=O)C(C)C(C(=O)OCC(C)C)(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C25H44O4/c1-18(2)16-28-23(26)20(5)25(21-12-8-6-9-13-21,22-14-10-7-11-15-22)24(27)29-17-19(3)4/h18-22H,6-17H2,1-5H3 |
| InChIKey | MTBAHYAPGSKLGX-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.62 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |