C22H36O4 — CID 175121286
1-O-(2-methylpropyl) 3-O-prop-2-enyl 2,2-dicyclohexylpropanedioate (PubChem CID 175121286) has the molecular formula C22H36O4 and a molecular weight of 364.53 g/mol. Its IUPAC name is 1-O-(2-methylpropyl) 3-O-prop-2-enyl 2,2-dicyclohexylpropanedioate.
| Compound Name | 1-O-(2-methylpropyl) 3-O-prop-2-enyl 2,2-dicyclohexylpropanedioate |
|---|---|
| PubChem CID | 175121286 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | 1-O-(2-methylpropyl) 3-O-prop-2-enyl 2,2-dicyclohexylpropanedioate |
| SMILES | C=CCOC(=O)C(C(=O)OCC(C)C)(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C22H36O4/c1-4-15-25-20(23)22(18-11-7-5-8-12-18,19-13-9-6-10-14-19)21(24)26-16-17(2)3/h4,17-19H,1,5-16H2,2-3H3 |
| InChIKey | UHSYZHYQEITZPC-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|