4-ethoxy-2,3,3-trimethyl-4-oxobutanoic acid

C9H16O4 — CID 22889431

IUPAC4-ethoxy-2,3,3-trimethyl-4-oxobutanoic acid
SMILESCCOC(=O)C(C)(C)C(C)C(=O)O
InChIInChI=1S/C9H16O4/c1-5-13-8(12)9(3,4)6(2)7(10)11/h6H,5H2,1-4H3,(H,10,11)
InChIKeyLOLCUVPLBFXJNO-UHFFFAOYSA-N
MW188.22 g/mol
LogP1.30
Rot. Bonds4

About 4-ethoxy-2,3,3-trimethyl-4-oxobutanoic acid

4-ethoxy-2,3,3-trimethyl-4-oxobutanoic acid (PubChem CID 22889431) has the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. Its IUPAC name is 4-ethoxy-2,3,3-trimethyl-4-oxobutanoic acid.

Molecular Properties

Compound Name4-ethoxy-2,3,3-trimethyl-4-oxobutanoic acid
PubChem CID22889431
Molecular FormulaC9H16O4
Molecular Weight188.22 g/mol
Exact Mass188.10
IUPAC Name4-ethoxy-2,3,3-trimethyl-4-oxobutanoic acid
SMILESCCOC(=O)C(C)(C)C(C)C(=O)O
InChIInChI=1S/C9H16O4/c1-5-13-8(12)9(3,4)6(2)7(10)11/h6H,5H2,1-4H3,(H,10,11)
InChIKeyLOLCUVPLBFXJNO-UHFFFAOYSA-N
XLogP1.30
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500188.22
LogP ≤ 51.30
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-ethoxy-2,3,3-trimethyl-4-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-ethoxy-2,3,3-trimethyl-4-oxobutanoic acid?
The IUPAC name of 4-ethoxy-2,3,3-trimethyl-4-oxobutanoic acid (CID 22889431) is 4-ethoxy-2,3,3-trimethyl-4-oxobutanoic acid.
What is the SMILES notation for 4-ethoxy-2,3,3-trimethyl-4-oxobutanoic acid?
The canonical SMILES for 4-ethoxy-2,3,3-trimethyl-4-oxobutanoic acid is CCOC(=O)C(C)(C)C(C)C(=O)O.
What is the InChIKey of 4-ethoxy-2,3,3-trimethyl-4-oxobutanoic acid?
The InChIKey is LOLCUVPLBFXJNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4/c1-5-13-8(12)9(3,4)6(2)7(10)11/h6H,5H2,1-4H3,(H,10,11).
What are the key properties of 4-ethoxy-2,3,3-trimethyl-4-oxobutanoic acid?
4-ethoxy-2,3,3-trimethyl-4-oxobutanoic acid has a molecular weight of 188.22 g/mol, XLogP of 1.30, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-2,3,3-trimethyl-4-oxobutanoic acid is sourced from PubChem (CID 22889431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).