C20H36O6 — CID 141254947
diethyl 3-(1-ethoxy-2-methyl-1-oxopropan-2-yl)-2,2,5,5-tetramethylhexanedioate (PubChem CID 141254947) has the molecular formula C20H36O6 and a molecular weight of 372.50 g/mol. Its IUPAC name is diethyl 3-(1-ethoxy-2-methyl-1-oxopropan-2-yl)-2,2,5,5-tetramethylhexanedioate.
| Compound Name | diethyl 3-(1-ethoxy-2-methyl-1-oxopropan-2-yl)-2,2,5,5-tetramethylhexanedioate |
|---|---|
| PubChem CID | 141254947 |
| Molecular Formula | C20H36O6 |
| Molecular Weight | 372.50 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | diethyl 3-(1-ethoxy-2-methyl-1-oxopropan-2-yl)-2,2,5,5-tetramethylhexanedioate |
| SMILES | CCOC(=O)C(C)(C)CC(C(C)(C)C(=O)OCC)C(C)(C)C(=O)OCC |
| InChI | InChI=1S/C20H36O6/c1-10-24-15(21)18(4,5)13-14(19(6,7)16(22)25-11-2)20(8,9)17(23)26-12-3/h14H,10-13H2,1-9H3 |
| InChIKey | HPADYIJZQOOQHD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|