C9H19O4PS2 — CID 101152507
methyl 2-di(propan-2-yloxy)phosphinothioylsulfanylacetate (PubChem CID 101152507) has the molecular formula C9H19O4PS2 and a molecular weight of 286.36 g/mol. Its IUPAC name is methyl 2-di(propan-2-yloxy)phosphinothioylsulfanylacetate.
| Compound Name | methyl 2-di(propan-2-yloxy)phosphinothioylsulfanylacetate |
|---|---|
| PubChem CID | 101152507 |
| Molecular Formula | C9H19O4PS2 |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | methyl 2-di(propan-2-yloxy)phosphinothioylsulfanylacetate |
| SMILES | COC(=O)CSP(=S)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C9H19O4PS2/c1-7(2)12-14(15,13-8(3)4)16-6-9(10)11-5/h7-8H,6H2,1-5H3 |
| InChIKey | QFRDHVXPJBEEEW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|