C23H39O4PS2 — CID 164686159
methyl 2-[bis[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]phosphinothioylsulfanyl]acetate (PubChem CID 164686159) has the molecular formula C23H39O4PS2 and a molecular weight of 474.67 g/mol. Its IUPAC name is methyl 2-[bis[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]phosphinothioylsulfanyl]acetate.
| Compound Name | methyl 2-[bis[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]phosphinothioylsulfanyl]acetate |
|---|---|
| PubChem CID | 164686159 |
| Molecular Formula | C23H39O4PS2 |
| Molecular Weight | 474.67 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | methyl 2-[bis[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]phosphinothioylsulfanyl]acetate |
| SMILES | COC(=O)CSP(=S)(OC1C2(C)CCC(C2)C1(C)C)OC1C2(C)CCC(C2)C1(C)C |
| InChI | InChI=1S/C23H39O4PS2/c1-20(2)15-8-10-22(5,12-15)18(20)26-28(29,30-14-17(24)25-7)27-19-21(3,4)16-9-11-23(19,6)13-16/h15-16,18-19H,8-14H2,1-7H3 |
| InChIKey | KCSCOJZSYNXSGT-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.67 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|