C11H19NOS — CID 130018039
O-[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)] carbamothioate (PubChem CID 130018039) has the molecular formula C11H19NOS and a molecular weight of 213.35 g/mol. Its IUPAC name is O-[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)] carbamothioate.
| Compound Name | O-[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)] carbamothioate |
|---|---|
| PubChem CID | 130018039 |
| Molecular Formula | C11H19NOS |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | O-[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)] carbamothioate |
| SMILES | CC12CCC(C1)C(C)(C)C2OC(N)=S |
| InChI | InChI=1S/C11H19NOS/c1-10(2)7-4-5-11(3,6-7)8(10)13-9(12)14/h7-8H,4-6H2,1-3H3,(H2,12,14) |
| InChIKey | KBAHSQWEBJTTHP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|