C26H30O2 — CID 101216321
trans-[(1S,2R,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl] (2R,3R)-2,3-diphenylcyclopropane-1-carboxylate (PubChem CID 101216321) has the molecular formula C26H30O2 and a molecular weight of 374.52 g/mol. Its IUPAC name is trans-[(1S,2R,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl] (2R,3R)-2,3-diphenylcyclopropane-1-carboxylate.
| Compound Name | trans-[(1S,2R,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl] (2R,3R)-2,3-diphenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 101216321 |
| Molecular Formula | C26H30O2 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | trans-[(1S,2R,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl] (2R,3R)-2,3-diphenylcyclopropane-1-carboxylate |
| SMILES | CC1(C)[C@@H]2CC[C@@](C)(C2)[C@H]1OC(=O)C1[C@H](c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C26H30O2/c1-25(2)19-14-15-26(3,16-19)24(25)28-23(27)22-20(17-10-6-4-7-11-17)21(22)18-12-8-5-9-13-18/h4-13,19-22,24H,14-16H2,1-3H3/t19-,20-,21-,24+,26+/m1/s1 |
| InChIKey | JBESIZWTPHSTJZ-IHWBNJRJSA-N |
| XLogP | 5.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |