C17H22O4 — CID 102122902
[(1R,2R,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl] 2,5-dihydroxybenzoate (PubChem CID 102122902) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is [(1R,2R,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl] 2,5-dihydroxybenzoate.
| Compound Name | [(1R,2R,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl] 2,5-dihydroxybenzoate |
|---|---|
| PubChem CID | 102122902 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | [(1R,2R,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl] 2,5-dihydroxybenzoate |
| SMILES | CC1(C)[C@H]2CC[C@](C)(C2)[C@H]1OC(=O)c1cc(O)ccc1O |
| InChI | InChI=1S/C17H22O4/c1-16(2)10-6-7-17(3,9-10)15(16)21-14(20)12-8-11(18)4-5-13(12)19/h4-5,8,10,15,18-19H,6-7,9H2,1-3H3/t10-,15-,17+/m0/s1 |
| InChIKey | GTVBZRPBECDRLX-GLZQIGESSA-N |
| XLogP | 3.47 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|