C22H28O8Sn — CID 16707575
[dibutyl-(2,5-dihydroxybenzoyl)oxystannyl] 2,5-dihydroxybenzoate (PubChem CID 16707575) has the molecular formula C22H28O8Sn and a molecular weight of 539.17 g/mol. Its IUPAC name is [dibutyl-(2,5-dihydroxybenzoyl)oxystannyl] 2,5-dihydroxybenzoate.
| Compound Name | [dibutyl-(2,5-dihydroxybenzoyl)oxystannyl] 2,5-dihydroxybenzoate |
|---|---|
| PubChem CID | 16707575 |
| Molecular Formula | C22H28O8Sn |
| Molecular Weight | 539.17 g/mol |
| Exact Mass | 540.08 |
| IUPAC Name | [dibutyl-(2,5-dihydroxybenzoyl)oxystannyl] 2,5-dihydroxybenzoate |
| SMILES | CCCC[Sn](CCCC)(OC(=O)c1cc(O)ccc1O)OC(=O)c1cc(O)ccc1O |
| InChI | InChI=1S/2C7H6O4.2C4H9.Sn/c2*8-4-1-2-6(9)5(3-4)7(10)11;2*1-3-4-2;/h2*1-3,8-9H,(H,10,11);2*1,3-4H2,2H3;/q;;;;+2/p-2 |
| InChIKey | INTHLNYVBRSRSF-UHFFFAOYSA-L |
| XLogP | 4.57 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.17 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|